C18H33O13P — CID 158282702
propan-2-yl [propan-2-yloxycarbonyloxymethoxy-[2-(3,4,5-trihydroxy-6-methyloxan-2-yl)ethyl]phosphoryl]oxymethyl carbonate (PubChem CID 158282702) has the molecular formula C18H33O13P and a molecular weight of 488.42 g/mol. Its IUPAC name is propan-2-yl [propan-2-yloxycarbonyloxymethoxy-[2-(3,4,5-trihydroxy-6-methyloxan-2-yl)ethyl]phosphoryl]oxymethyl carbonate.
| Compound Name | propan-2-yl [propan-2-yloxycarbonyloxymethoxy-[2-(3,4,5-trihydroxy-6-methyloxan-2-yl)ethyl]phosphoryl]oxymethyl carbonate |
|---|---|
| PubChem CID | 158282702 |
| Molecular Formula | C18H33O13P |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | propan-2-yl [propan-2-yloxycarbonyloxymethoxy-[2-(3,4,5-trihydroxy-6-methyloxan-2-yl)ethyl]phosphoryl]oxymethyl carbonate |
| SMILES | CC(C)OC(=O)OCOP(=O)(CCC1OC(C)C(O)C(O)C1O)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C18H33O13P/c1-10(2)29-17(22)25-8-27-32(24,28-9-26-18(23)30-11(3)4)7-6-13-15(20)16(21)14(19)12(5)31-13/h10-16,19-21H,6-9H2,1-5H3 |
| InChIKey | WCFPDDBJCYMQJE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|