C12H21O8P — CID 57342897
(1S,5R,6R,8R)-9-(diethoxyphosphorylmethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol (PubChem CID 57342897) has the molecular formula C12H21O8P and a molecular weight of 324.27 g/mol. Its IUPAC name is (1S,5R,6R,8R)-9-(diethoxyphosphorylmethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol.
| Compound Name | (1S,5R,6R,8R)-9-(diethoxyphosphorylmethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
|---|---|
| PubChem CID | 57342897 |
| Molecular Formula | C12H21O8P |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (1S,5R,6R,8R)-9-(diethoxyphosphorylmethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
| SMILES | CCOP(=O)(CC1[C@H]2OC3OC([C@@H]2O)[C@H](O)[C@H]1O3)OCC |
| InChI | InChI=1S/C12H21O8P/c1-3-16-21(15,17-4-2)5-6-9-7(13)11-8(14)10(6)19-12(18-9)20-11/h6-14H,3-5H2,1-2H3/t6?,7-,8-,9-,10+,11?,12?/m1/s1 |
| InChIKey | GMMPUZLVHXVQMH-IOPMLCHLSA-N |
| XLogP | 0.07 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|