C11H24NO7P — CID 135053796
(2S,3S,4S,5S,6R)-2-(diethoxyphosphorylmethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 135053796) has the molecular formula C11H24NO7P and a molecular weight of 313.29 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-(diethoxyphosphorylmethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3S,4S,5S,6R)-2-(diethoxyphosphorylmethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 135053796 |
| Molecular Formula | C11H24NO7P |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-(diethoxyphosphorylmethyl)-6-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCOP(=O)(C[C@H]1N[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)OCC |
| InChI | InChI=1S/C11H24NO7P/c1-3-18-20(17,19-4-2)6-8-10(15)11(16)9(14)7(5-13)12-8/h7-16H,3-6H2,1-2H3/t7-,8-,9+,10+,11+/m1/s1 |
| InChIKey | SSEBBKSIULEALE-UVOCVTCTSA-N |
| XLogP | -1.33 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|