About 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride
2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride (PubChem CID 73001219) has the molecular formula C6H14ClNO4
and a molecular weight of 199.63 g/mol. Its IUPAC name is 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride.
Molecular Properties
| Compound Name | 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride |
| PubChem CID | 73001219 |
| Molecular Formula | C6H14ClNO4 |
| Molecular Weight | 199.63 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride |
| SMILES | Cl.OCC1NC(CO)C(O)C1O |
| InChI | InChI=1S/C6H13NO4.ClH/c8-1-3-5(10)6(11)4(2-9)7-3;/h3-11H,1-2H2;1H |
| InChIKey | ASOISZHLRDHELT-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.63 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride?
The IUPAC name of 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride (CID 73001219) is 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride.
What is the SMILES notation for 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride?
The canonical SMILES for 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride is Cl.OCC1NC(CO)C(O)C1O.
What is the InChIKey of 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride?
The InChIKey is ASOISZHLRDHELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4.ClH/c8-1-3-5(10)6(11)4(2-9)7-3;/h3-11H,1-2H2;1H.
What are the key properties of 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride?
2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride has a molecular weight of 199.63 g/mol, XLogP of -2.55, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride is sourced from PubChem (CID 73001219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).