C4H9NO2 — CID 139760499
[(2R,3S)-3-(hydroxymethyl)aziridin-2-yl]methanol (PubChem CID 139760499) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is [(2R,3S)-3-(hydroxymethyl)aziridin-2-yl]methanol.
| Compound Name | [(2R,3S)-3-(hydroxymethyl)aziridin-2-yl]methanol |
|---|---|
| PubChem CID | 139760499 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | [(2R,3S)-3-(hydroxymethyl)aziridin-2-yl]methanol |
| SMILES | OC[C@@H]1N[C@@H]1CO |
| InChI | InChI=1S/C4H9NO2/c6-1-3-4(2-7)5-3/h3-7H,1-2H2/t3-,4+ |
| InChIKey | NVZSIOPHWFPCPE-ZXZARUISSA-N |
| XLogP | -1.69 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|