C14H30O7P2 — CID 145422347
(2S,5S)-2,5-bis(diethoxyphosphorylmethyl)oxolane (PubChem CID 145422347) has the molecular formula C14H30O7P2 and a molecular weight of 372.34 g/mol. Its IUPAC name is (2S,5S)-2,5-bis(diethoxyphosphorylmethyl)oxolane.
| Compound Name | (2S,5S)-2,5-bis(diethoxyphosphorylmethyl)oxolane |
|---|---|
| PubChem CID | 145422347 |
| Molecular Formula | C14H30O7P2 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (2S,5S)-2,5-bis(diethoxyphosphorylmethyl)oxolane |
| SMILES | CCOP(=O)(C[C@@H]1CC[C@@H](CP(=O)(OCC)OCC)O1)OCC |
| InChI | InChI=1S/C14H30O7P2/c1-5-17-22(15,18-6-2)11-13-9-10-14(21-13)12-23(16,19-7-3)20-8-4/h13-14H,5-12H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | JPSPMGKSBWIOEF-KBPBESRZSA-N |
| XLogP | 4.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|