C13H29NO7P2 — CID 134998390
(3S,5R)-3-diethoxyphosphoryl-5-(diethoxyphosphorylmethyl)-2-methyl-1,2-oxazolidine (PubChem CID 134998390) has the molecular formula C13H29NO7P2 and a molecular weight of 373.32 g/mol. Its IUPAC name is (3S,5R)-3-diethoxyphosphoryl-5-(diethoxyphosphorylmethyl)-2-methyl-1,2-oxazolidine.
| Compound Name | (3S,5R)-3-diethoxyphosphoryl-5-(diethoxyphosphorylmethyl)-2-methyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134998390 |
| Molecular Formula | C13H29NO7P2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3S,5R)-3-diethoxyphosphoryl-5-(diethoxyphosphorylmethyl)-2-methyl-1,2-oxazolidine |
| SMILES | CCOP(=O)(C[C@H]1C[C@H](P(=O)(OCC)OCC)N(C)O1)OCC |
| InChI | InChI=1S/C13H29NO7P2/c1-6-17-22(15,18-7-2)11-12-10-13(14(5)21-12)23(16,19-8-3)20-9-4/h12-13H,6-11H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | YGGPGPOUIYIRPZ-OLZOCXBDSA-N |
| XLogP | 3.48 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|