C15H24NO4P — CID 72946419
(3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(4-methylphenyl)-1,2-oxazolidine (PubChem CID 72946419) has the molecular formula C15H24NO4P and a molecular weight of 313.33 g/mol. Its IUPAC name is (3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(4-methylphenyl)-1,2-oxazolidine.
| Compound Name | (3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(4-methylphenyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 72946419 |
| Molecular Formula | C15H24NO4P |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(4-methylphenyl)-1,2-oxazolidine |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@H](c2ccc(C)cc2)ON1C |
| InChI | InChI=1S/C15H24NO4P/c1-5-18-21(17,19-6-2)15-11-14(20-16(15)4)13-9-7-12(3)8-10-13/h7-10,14-15H,5-6,11H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | KALMRLCHLWHOND-CABCVRRESA-N |
| XLogP | 3.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|