C16H25N2O5P — CID 71718927
(3S,5R)-3-diethoxyphosphoryl-2-methyl-N-(3-methylphenyl)-1,2-oxazolidine-5-carboxamide (PubChem CID 71718927) has the molecular formula C16H25N2O5P and a molecular weight of 356.36 g/mol. Its IUPAC name is (3S,5R)-3-diethoxyphosphoryl-2-methyl-N-(3-methylphenyl)-1,2-oxazolidine-5-carboxamide.
| Compound Name | (3S,5R)-3-diethoxyphosphoryl-2-methyl-N-(3-methylphenyl)-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71718927 |
| Molecular Formula | C16H25N2O5P |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (3S,5R)-3-diethoxyphosphoryl-2-methyl-N-(3-methylphenyl)-1,2-oxazolidine-5-carboxamide |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@H](C(=O)Nc2cccc(C)c2)ON1C |
| InChI | InChI=1S/C16H25N2O5P/c1-5-21-24(20,22-6-2)15-11-14(23-18(15)4)16(19)17-13-9-7-8-12(3)10-13/h7-10,14-15H,5-6,11H2,1-4H3,(H,17,19)/t14-,15+/m1/s1 |
| InChIKey | NSBVNGZSDFLXLU-CABCVRRESA-N |
| XLogP | 3.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|