C17H25N2O6P — CID 71718940
(3S,5R)-N-(4-acetylphenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide (PubChem CID 71718940) has the molecular formula C17H25N2O6P and a molecular weight of 384.37 g/mol. Its IUPAC name is (3S,5R)-N-(4-acetylphenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide.
| Compound Name | (3S,5R)-N-(4-acetylphenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71718940 |
| Molecular Formula | C17H25N2O6P |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3S,5R)-N-(4-acetylphenyl)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidine-5-carboxamide |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@H](C(=O)Nc2ccc(C(C)=O)cc2)ON1C |
| InChI | InChI=1S/C17H25N2O6P/c1-5-23-26(22,24-6-2)16-11-15(25-19(16)4)17(21)18-14-9-7-13(8-10-14)12(3)20/h7-10,15-16H,5-6,11H2,1-4H3,(H,18,21)/t15-,16+/m1/s1 |
| InChIKey | KERUXODKKFCNSP-CVEARBPZSA-N |
| XLogP | 3.06 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|