C16H26NO6P — CID 72946420
(3S,5R)-3-diethoxyphosphoryl-5-(2,4-dimethoxyphenyl)-2-methyl-1,2-oxazolidine (PubChem CID 72946420) has the molecular formula C16H26NO6P and a molecular weight of 359.36 g/mol. Its IUPAC name is (3S,5R)-3-diethoxyphosphoryl-5-(2,4-dimethoxyphenyl)-2-methyl-1,2-oxazolidine.
| Compound Name | (3S,5R)-3-diethoxyphosphoryl-5-(2,4-dimethoxyphenyl)-2-methyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 72946420 |
| Molecular Formula | C16H26NO6P |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3S,5R)-3-diethoxyphosphoryl-5-(2,4-dimethoxyphenyl)-2-methyl-1,2-oxazolidine |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@H](c2ccc(OC)cc2OC)ON1C |
| InChI | InChI=1S/C16H26NO6P/c1-6-21-24(18,22-7-2)16-11-15(23-17(16)3)13-9-8-12(19-4)10-14(13)20-5/h8-10,15-16H,6-7,11H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | FIOARVZBASAEKY-CVEARBPZSA-N |
| XLogP | 3.60 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|