C24H24O5S — CID 100944584
(2R,3S,5S)-3-(benzenesulfonyl)-2-(2,4-dimethoxyphenyl)-5-phenyloxolane (PubChem CID 100944584) has the molecular formula C24H24O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is (2R,3S,5S)-3-(benzenesulfonyl)-2-(2,4-dimethoxyphenyl)-5-phenyloxolane.
| Compound Name | (2R,3S,5S)-3-(benzenesulfonyl)-2-(2,4-dimethoxyphenyl)-5-phenyloxolane |
|---|---|
| PubChem CID | 100944584 |
| Molecular Formula | C24H24O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2R,3S,5S)-3-(benzenesulfonyl)-2-(2,4-dimethoxyphenyl)-5-phenyloxolane |
| SMILES | COc1ccc([C@H]2O[C@H](c3ccccc3)C[C@@H]2S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H24O5S/c1-27-18-13-14-20(22(15-18)28-2)24-23(30(25,26)19-11-7-4-8-12-19)16-21(29-24)17-9-5-3-6-10-17/h3-15,21,23-24H,16H2,1-2H3/t21-,23-,24+/m0/s1 |
| InChIKey | KETFRAFWRSVIFI-OEMFJLHTSA-N |
| XLogP | 4.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |