C17H19NO5S — CID 110740481
3-(2,4-dimethoxyphenyl)sulfonyl-5-phenyl-1,3-oxazolidine (PubChem CID 110740481) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)sulfonyl-5-phenyl-1,3-oxazolidine.
| Compound Name | 3-(2,4-dimethoxyphenyl)sulfonyl-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740481 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)sulfonyl-5-phenyl-1,3-oxazolidine |
| SMILES | COc1ccc(S(=O)(=O)N2COC(c3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C17H19NO5S/c1-21-14-8-9-17(15(10-14)22-2)24(19,20)18-11-16(23-12-18)13-6-4-3-5-7-13/h3-10,16H,11-12H2,1-2H3 |
| InChIKey | VFDFXJBKOJTDKC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |