C21H26N2O11S2 — CID 57401834
(4R,5R)-1,3-bis[(2,4-dimethoxyphenyl)sulfonyl]-4,5-dimethoxyimidazolidin-2-one (PubChem CID 57401834) has the molecular formula C21H26N2O11S2 and a molecular weight of 546.58 g/mol. Its IUPAC name is (4R,5R)-1,3-bis[(2,4-dimethoxyphenyl)sulfonyl]-4,5-dimethoxyimidazolidin-2-one.
| Compound Name | (4R,5R)-1,3-bis[(2,4-dimethoxyphenyl)sulfonyl]-4,5-dimethoxyimidazolidin-2-one |
|---|---|
| PubChem CID | 57401834 |
| Molecular Formula | C21H26N2O11S2 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (4R,5R)-1,3-bis[(2,4-dimethoxyphenyl)sulfonyl]-4,5-dimethoxyimidazolidin-2-one |
| SMILES | COc1ccc(S(=O)(=O)N2C(=O)N(S(=O)(=O)c3ccc(OC)cc3OC)[C@H](OC)[C@H]2OC)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O11S2/c1-29-13-7-9-17(15(11-13)31-3)35(25,26)22-19(33-5)20(34-6)23(21(22)24)36(27,28)18-10-8-14(30-2)12-16(18)32-4/h7-12,19-20H,1-6H3/t19-,20-/m1/s1 |
| InChIKey | JURCWQCGXNKBOZ-WOJBJXKFSA-N |
| XLogP | 1.48 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |