C12H17NO4S2 — CID 122331910
3-(2,4-dimethoxyphenyl)sulfonyl-2-methyl-1,3-thiazolidine (PubChem CID 122331910) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)sulfonyl-2-methyl-1,3-thiazolidine.
| Compound Name | 3-(2,4-dimethoxyphenyl)sulfonyl-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 122331910 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)sulfonyl-2-methyl-1,3-thiazolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCSC2C)c(OC)c1 |
| InChI | InChI=1S/C12H17NO4S2/c1-9-13(6-7-18-9)19(14,15)12-5-4-10(16-2)8-11(12)17-3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | AOZKXGXXFVNXFI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |