C22H29NO7S2 — CID 122330957
3-(2,4-diethoxyphenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine (PubChem CID 122330957) has the molecular formula C22H29NO7S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-(2,4-diethoxyphenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine.
| Compound Name | 3-(2,4-diethoxyphenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 122330957 |
| Molecular Formula | C22H29NO7S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-(2,4-diethoxyphenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCSC2c2cc(OC)c(OC)cc2OC)c(OCC)c1 |
| InChI | InChI=1S/C22H29NO7S2/c1-6-29-15-8-9-21(20(12-15)30-7-2)32(24,25)23-10-11-31-22(23)16-13-18(27-4)19(28-5)14-17(16)26-3/h8-9,12-14,22H,6-7,10-11H2,1-5H3 |
| InChIKey | MMWXRXGGDKGMRV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |