C20H25NO4S — CID 110327378
4-(4-methoxy-2-methylphenyl)sulfonyl-5,5-dimethyl-2-phenylmorpholine (PubChem CID 110327378) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylphenyl)sulfonyl-5,5-dimethyl-2-phenylmorpholine.
| Compound Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-5,5-dimethyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 110327378 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-5,5-dimethyl-2-phenylmorpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CC(c3ccccc3)OCC2(C)C)c(C)c1 |
| InChI | InChI=1S/C20H25NO4S/c1-15-12-17(24-4)10-11-19(15)26(22,23)21-13-18(25-14-20(21,2)3)16-8-6-5-7-9-16/h5-12,18H,13-14H2,1-4H3 |
| InChIKey | HHXVGVKNRKCJDC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |