C15H23NO4S — CID 48629627
4-(4-methoxy-2-methylphenyl)sulfonyl-2,2,6-trimethylmorpholine (PubChem CID 48629627) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylphenyl)sulfonyl-2,2,6-trimethylmorpholine.
| Compound Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-2,2,6-trimethylmorpholine |
|---|---|
| PubChem CID | 48629627 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-2,2,6-trimethylmorpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)OC(C)(C)C2)c(C)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-11-8-13(19-5)6-7-14(11)21(17,18)16-9-12(2)20-15(3,4)10-16/h6-8,12H,9-10H2,1-5H3 |
| InChIKey | XIVQTLGFNFVCKI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |