C14H20N2O4S — CID 110708313
4-(4-methoxy-2-methylphenyl)sulfonyl-1,3-dimethylpiperazin-2-one (PubChem CID 110708313) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylphenyl)sulfonyl-1,3-dimethylpiperazin-2-one.
| Compound Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-1,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 110708313 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-1,3-dimethylpiperazin-2-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C)C(=O)C2C)c(C)c1 |
| InChI | InChI=1S/C14H20N2O4S/c1-10-9-12(20-4)5-6-13(10)21(18,19)16-8-7-15(3)14(17)11(16)2/h5-6,9,11H,7-8H2,1-4H3 |
| InChIKey | KPDBBGULJVCXHO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |