C13H15ClN2O5S — CID 110708343
4-chloro-3-(2,4-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzoic acid (PubChem CID 110708343) has the molecular formula C13H15ClN2O5S and a molecular weight of 346.79 g/mol. Its IUPAC name is 4-chloro-3-(2,4-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzoic acid.
| Compound Name | 4-chloro-3-(2,4-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 110708343 |
| Molecular Formula | C13H15ClN2O5S |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-chloro-3-(2,4-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzoic acid |
| SMILES | CC1C(=O)N(C)CCN1S(=O)(=O)c1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O5S/c1-8-12(17)15(2)5-6-16(8)22(20,21)11-7-9(13(18)19)3-4-10(11)14/h3-4,7-8H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | HBDXDGMSASDZJA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |