About 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine
1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine (PubChem CID 110290267) has the molecular formula C17H28N2O4S
and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine |
| PubChem CID | 110290267 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine |
| SMILES | COCCN1C(C)CN(S(=O)(=O)c2ccc(OC)cc2C)CC1C |
| InChI | InChI=1S/C17H28N2O4S/c1-13-10-16(23-5)6-7-17(13)24(20,21)18-11-14(2)19(8-9-22-4)15(3)12-18/h6-7,10,14-15H,8-9,11-12H2,1-5H3 |
| InChIKey | PSJSOGZJFZSOQE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine?
The IUPAC name of 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine (CID 110290267) is 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine.
What is the SMILES notation for 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine?
The canonical SMILES for 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine is COCCN1C(C)CN(S(=O)(=O)c2ccc(OC)cc2C)CC1C.
What is the InChIKey of 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine?
The InChIKey is PSJSOGZJFZSOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O4S/c1-13-10-16(23-5)6-7-17(13)24(20,21)18-11-14(2)19(8-9-22-4)15(3)12-18/h6-7,10,14-15H,8-9,11-12H2,1-5H3.
What are the key properties of 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine?
1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine has a molecular weight of 356.49 g/mol, XLogP of 1.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-4-(4-methoxy-2-methylphenyl)sulfonyl-2,6-dimethylpiperazine is sourced from PubChem (CID 110290267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).