C19H22N2O4S — CID 110420094
4-(4-methoxy-2-methylphenyl)sulfonyl-3-(4-methylphenyl)piperazin-2-one (PubChem CID 110420094) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylphenyl)sulfonyl-3-(4-methylphenyl)piperazin-2-one.
| Compound Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-3-(4-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 110420094 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-(4-methoxy-2-methylphenyl)sulfonyl-3-(4-methylphenyl)piperazin-2-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCNC(=O)C2c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13-4-6-15(7-5-13)18-19(22)20-10-11-21(18)26(23,24)17-9-8-16(25-3)12-14(17)2/h4-9,12,18H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | VUDMWSLVXLEVFY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |