About 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine
4-(benzenesulfonyl)-2,2,6-trimethylmorpholine (PubChem CID 47429979) has the molecular formula C13H19NO3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine.
Molecular Properties
| Compound Name | 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine |
| PubChem CID | 47429979 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccccc2)CC(C)(C)O1 |
| InChI | InChI=1S/C13H19NO3S/c1-11-9-14(10-13(2,3)17-11)18(15,16)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | BTWHGYFKBCUCJD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine?
The IUPAC name of 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine (CID 47429979) is 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine.
What is the SMILES notation for 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine?
The canonical SMILES for 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine is CC1CN(S(=O)(=O)c2ccccc2)CC(C)(C)O1.
What is the InChIKey of 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine?
The InChIKey is BTWHGYFKBCUCJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3S/c1-11-9-14(10-13(2,3)17-11)18(15,16)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3.
What are the key properties of 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine?
4-(benzenesulfonyl)-2,2,6-trimethylmorpholine has a molecular weight of 269.37 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonyl)-2,2,6-trimethylmorpholine is sourced from PubChem (CID 47429979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).