C12H18N2O3S — CID 47429920
2,2,6-trimethyl-4-pyridin-3-ylsulfonylmorpholine (PubChem CID 47429920) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2,2,6-trimethyl-4-pyridin-3-ylsulfonylmorpholine.
| Compound Name | 2,2,6-trimethyl-4-pyridin-3-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 47429920 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2,2,6-trimethyl-4-pyridin-3-ylsulfonylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cccnc2)CC(C)(C)O1 |
| InChI | InChI=1S/C12H18N2O3S/c1-10-8-14(9-12(2,3)17-10)18(15,16)11-5-4-6-13-7-11/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | MOGSQRHBVQNPNR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |