C19H22FNO3S — CID 110368983
2-(2-fluorophenyl)-5,5-dimethyl-4-(2-methylphenyl)sulfonylmorpholine (PubChem CID 110368983) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5,5-dimethyl-4-(2-methylphenyl)sulfonylmorpholine.
| Compound Name | 2-(2-fluorophenyl)-5,5-dimethyl-4-(2-methylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 110368983 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(2-fluorophenyl)-5,5-dimethyl-4-(2-methylphenyl)sulfonylmorpholine |
| SMILES | Cc1ccccc1S(=O)(=O)N1CC(c2ccccc2F)OCC1(C)C |
| InChI | InChI=1S/C19H22FNO3S/c1-14-8-4-7-11-18(14)25(22,23)21-12-17(24-13-19(21,2)3)15-9-5-6-10-16(15)20/h4-11,17H,12-13H2,1-3H3 |
| InChIKey | YJOOTZIFQVEKJD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |