C16H23FN2O2 — CID 110368946
2-(2-fluorophenyl)-5,5-dimethyl-N-propylmorpholine-4-carboxamide (PubChem CID 110368946) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5,5-dimethyl-N-propylmorpholine-4-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-5,5-dimethyl-N-propylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 110368946 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(2-fluorophenyl)-5,5-dimethyl-N-propylmorpholine-4-carboxamide |
| SMILES | CCCNC(=O)N1CC(c2ccccc2F)OCC1(C)C |
| InChI | InChI=1S/C16H23FN2O2/c1-4-9-18-15(20)19-10-14(21-11-16(19,2)3)12-7-5-6-8-13(12)17/h5-8,14H,4,9-11H2,1-3H3,(H,18,20) |
| InChIKey | FXROIZNTOJDSTM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |