C13H19NO3S — CID 110740928
2,4,4-trimethyl-3-(2-methylphenyl)sulfonyl-1,3-oxazolidine (PubChem CID 110740928) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-(2-methylphenyl)sulfonyl-1,3-oxazolidine.
| Compound Name | 2,4,4-trimethyl-3-(2-methylphenyl)sulfonyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740928 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2,4,4-trimethyl-3-(2-methylphenyl)sulfonyl-1,3-oxazolidine |
| SMILES | Cc1ccccc1S(=O)(=O)N1C(C)OCC1(C)C |
| InChI | InChI=1S/C13H19NO3S/c1-10-7-5-6-8-12(10)18(15,16)14-11(2)17-9-13(14,3)4/h5-8,11H,9H2,1-4H3 |
| InChIKey | TZXDLQZEDZPSMV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |