C15H23NO3S — CID 110740910
2,4,4-trimethyl-3-(3-phenylpropylsulfonyl)-1,3-oxazolidine (PubChem CID 110740910) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-(3-phenylpropylsulfonyl)-1,3-oxazolidine.
| Compound Name | 2,4,4-trimethyl-3-(3-phenylpropylsulfonyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740910 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2,4,4-trimethyl-3-(3-phenylpropylsulfonyl)-1,3-oxazolidine |
| SMILES | CC1OCC(C)(C)N1S(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C15H23NO3S/c1-13-16(15(2,3)12-19-13)20(17,18)11-7-10-14-8-5-4-6-9-14/h4-6,8-9,13H,7,10-12H2,1-3H3 |
| InChIKey | GVMGRPRLCZODQS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |