C17H27NO3S — CID 110725489
1-(3-phenylpropylsulfonyl)-4-propan-2-yloxypiperidine (PubChem CID 110725489) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 1-(3-phenylpropylsulfonyl)-4-propan-2-yloxypiperidine.
| Compound Name | 1-(3-phenylpropylsulfonyl)-4-propan-2-yloxypiperidine |
|---|---|
| PubChem CID | 110725489 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-(3-phenylpropylsulfonyl)-4-propan-2-yloxypiperidine |
| SMILES | CC(C)OC1CCN(S(=O)(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H27NO3S/c1-15(2)21-17-10-12-18(13-11-17)22(19,20)14-6-9-16-7-4-3-5-8-16/h3-5,7-8,15,17H,6,9-14H2,1-2H3 |
| InChIKey | JJWFJUCMBMQRTM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |