C15H23NO4S — CID 175064868
(4-benzyl-5,5-dimethylmorpholin-2-yl) ethanesulfonate (PubChem CID 175064868) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is (4-benzyl-5,5-dimethylmorpholin-2-yl) ethanesulfonate.
| Compound Name | (4-benzyl-5,5-dimethylmorpholin-2-yl) ethanesulfonate |
|---|---|
| PubChem CID | 175064868 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (4-benzyl-5,5-dimethylmorpholin-2-yl) ethanesulfonate |
| SMILES | CCS(=O)(=O)OC1CN(Cc2ccccc2)C(C)(C)CO1 |
| InChI | InChI=1S/C15H23NO4S/c1-4-21(17,18)20-14-11-16(15(2,3)12-19-14)10-13-8-6-5-7-9-13/h5-9,14H,4,10-12H2,1-3H3 |
| InChIKey | FSEDDPMDUOWPDT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|