C14H22N2 — CID 94985398
(5R)-1-benzyl-2,2,5-trimethylpiperazine (PubChem CID 94985398) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (5R)-1-benzyl-2,2,5-trimethylpiperazine.
| Compound Name | (5R)-1-benzyl-2,2,5-trimethylpiperazine |
|---|---|
| PubChem CID | 94985398 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (5R)-1-benzyl-2,2,5-trimethylpiperazine |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C(C)(C)CN1 |
| InChI | InChI=1S/C14H22N2/c1-12-9-16(14(2,3)11-15-12)10-13-7-5-4-6-8-13/h4-8,12,15H,9-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | HIWHYNYFFGYGLP-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |