About 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine
2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine (PubChem CID 110643844) has the molecular formula C21H27NO3S
and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine.
Molecular Properties
| Compound Name | 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine |
| PubChem CID | 110643844 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine |
| SMILES | Cc1ccc(CS(=O)(=O)N2CC(Cc3ccccc3)OCC2(C)C)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-17-9-11-19(12-10-17)15-26(23,24)22-14-20(25-16-21(22,2)3)13-18-7-5-4-6-8-18/h4-12,20H,13-16H2,1-3H3 |
| InChIKey | SRMBDYWZCIGBAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine?
The IUPAC name of 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine (CID 110643844) is 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine.
What is the SMILES notation for 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine?
The canonical SMILES for 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine is Cc1ccc(CS(=O)(=O)N2CC(Cc3ccccc3)OCC2(C)C)cc1.
What is the InChIKey of 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine?
The InChIKey is SRMBDYWZCIGBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO3S/c1-17-9-11-19(12-10-17)15-26(23,24)22-14-20(25-16-21(22,2)3)13-18-7-5-4-6-8-18/h4-12,20H,13-16H2,1-3H3.
What are the key properties of 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine?
2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine has a molecular weight of 373.52 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine is sourced from PubChem (CID 110643844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).