C23H29NO3 — CID 110643790
1-(2-benzyl-5,5-dimethylmorpholin-4-yl)-2-(4-ethoxyphenyl)ethanone (PubChem CID 110643790) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-(2-benzyl-5,5-dimethylmorpholin-4-yl)-2-(4-ethoxyphenyl)ethanone.
| Compound Name | 1-(2-benzyl-5,5-dimethylmorpholin-4-yl)-2-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 110643790 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-(2-benzyl-5,5-dimethylmorpholin-4-yl)-2-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CC(Cc3ccccc3)OCC2(C)C)cc1 |
| InChI | InChI=1S/C23H29NO3/c1-4-26-20-12-10-19(11-13-20)15-22(25)24-16-21(27-17-23(24,2)3)14-18-8-6-5-7-9-18/h5-13,21H,4,14-17H2,1-3H3 |
| InChIKey | RBRPQAYYUVPMFS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |