C18H29NO2 — CID 162723839
1-[(2S)-4-benzyl-5,5-dimethylmorpholin-2-yl]-2,2-dimethylpropan-1-ol (PubChem CID 162723839) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 1-[(2S)-4-benzyl-5,5-dimethylmorpholin-2-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[(2S)-4-benzyl-5,5-dimethylmorpholin-2-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 162723839 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[(2S)-4-benzyl-5,5-dimethylmorpholin-2-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)[C@@H]1CN(Cc2ccccc2)C(C)(C)CO1 |
| InChI | InChI=1S/C18H29NO2/c1-17(2,3)16(20)15-12-19(18(4,5)13-21-15)11-14-9-7-6-8-10-14/h6-10,15-16,20H,11-13H2,1-5H3/t15-,16?/m0/s1 |
| InChIKey | PKAMTVXGXAOBJC-VYRBHSGPSA-N |
| XLogP | 3.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |