C16H25N — CID 563397
1-benzyl-3-tert-butyl-2,2-dimethylazetidine (PubChem CID 563397) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-benzyl-3-tert-butyl-2,2-dimethylazetidine.
| Compound Name | 1-benzyl-3-tert-butyl-2,2-dimethylazetidine |
|---|---|
| PubChem CID | 563397 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-benzyl-3-tert-butyl-2,2-dimethylazetidine |
| SMILES | CC(C)(C)C1CN(Cc2ccccc2)C1(C)C |
| InChI | InChI=1S/C16H25N/c1-15(2,3)14-12-17(16(14,4)5)11-13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3 |
| InChIKey | FMCVPLJPSGGKLH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |