C18H20ClN — CID 11087372
(2R,4R)-1-benzyl-4-chloro-2-methyl-2-phenylpyrrolidine (PubChem CID 11087372) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is (2R,4R)-1-benzyl-4-chloro-2-methyl-2-phenylpyrrolidine.
| Compound Name | (2R,4R)-1-benzyl-4-chloro-2-methyl-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 11087372 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2R,4R)-1-benzyl-4-chloro-2-methyl-2-phenylpyrrolidine |
| SMILES | C[C@]1(c2ccccc2)C[C@@H](Cl)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H20ClN/c1-18(16-10-6-3-7-11-16)12-17(19)14-20(18)13-15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | YTKDRZMITUVSFW-QZTJIDSGSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|