C17H19NO — CID 101229912
(2S)-3-benzyl-2-methyl-2-phenyl-1,3-oxazolidine (PubChem CID 101229912) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (2S)-3-benzyl-2-methyl-2-phenyl-1,3-oxazolidine.
| Compound Name | (2S)-3-benzyl-2-methyl-2-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 101229912 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2S)-3-benzyl-2-methyl-2-phenyl-1,3-oxazolidine |
| SMILES | C[C@@]1(c2ccccc2)OCCN1Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-17(16-10-6-3-7-11-16)18(12-13-19-17)14-15-8-4-2-5-9-15/h2-11H,12-14H2,1H3/t17-/m0/s1 |
| InChIKey | PAELRWAWUMHXAM-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |