C13H17NO2 — CID 70380943
1-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane (PubChem CID 70380943) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane.
| Compound Name | 1-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 70380943 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-benzyl-5,8-dioxa-1-azaspiro[3.5]nonane |
| SMILES | c1ccc(CN2CCC23COCCO3)cc1 |
| InChI | InChI=1S/C13H17NO2/c1-2-4-12(5-3-1)10-14-7-6-13(14)11-15-8-9-16-13/h1-5H,6-11H2 |
| InChIKey | CWMCZGCTTOVVSM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |