C14H19NO2 — CID 11053540
7-benzyl-1,4-dimethyl-2,6-dioxa-7-azabicyclo[2.2.2]octane (PubChem CID 11053540) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 7-benzyl-1,4-dimethyl-2,6-dioxa-7-azabicyclo[2.2.2]octane.
| Compound Name | 7-benzyl-1,4-dimethyl-2,6-dioxa-7-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 11053540 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 7-benzyl-1,4-dimethyl-2,6-dioxa-7-azabicyclo[2.2.2]octane |
| SMILES | CC12COC(C)(OC1)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H19NO2/c1-13-9-15(8-12-6-4-3-5-7-12)14(2,16-10-13)17-11-13/h3-7H,8-11H2,1-2H3 |
| InChIKey | IYXLQMDQVFVWHD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |