C31H41NO2Si — CID 163246812
1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethylpiperidin-3-ol (PubChem CID 163246812) has the molecular formula C31H41NO2Si and a molecular weight of 487.76 g/mol. Its IUPAC name is 1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethylpiperidin-3-ol.
| Compound Name | 1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 163246812 |
| Molecular Formula | C31H41NO2Si |
| Molecular Weight | 487.76 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethylpiperidin-3-ol |
| SMILES | CC1(C)C(O)CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C31H41NO2Si/c1-30(2,3)35(27-17-11-7-12-18-27,28-19-13-8-14-20-28)34-24-26-21-29(33)31(4,5)32(23-26)22-25-15-9-6-10-16-25/h6-20,26,29,33H,21-24H2,1-5H3 |
| InChIKey | RRLYCXRSUKCQFB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.76 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|