C31H42N2OSi — CID 142426134
2-[(5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]propan-2-amine (PubChem CID 142426134) has the molecular formula C31H42N2OSi and a molecular weight of 486.78 g/mol. Its IUPAC name is 2-[(5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]propan-2-amine.
| Compound Name | 2-[(5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 142426134 |
| Molecular Formula | C31H42N2OSi |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 2-[(5S)-1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]propan-2-amine |
| SMILES | CC(C)(N)C1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H42N2OSi/c1-30(2,3)35(28-17-11-7-12-18-28,29-19-13-8-14-20-29)34-24-27-21-26(31(4,5)32)23-33(27)22-25-15-9-6-10-16-25/h6-20,26-27H,21-24,32H2,1-5H3/t26?,27-/m0/s1 |
| InChIKey | KYIVVNSIXGIPJG-GEVKEYJPSA-N |
| XLogP | 5.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|