C31H35N3O4Si — CID 134937707
3-[(3R,5R)-2-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-5-yl]-1H-pyrimidine-2,4-dione (PubChem CID 134937707) has the molecular formula C31H35N3O4Si and a molecular weight of 541.72 g/mol. Its IUPAC name is 3-[(3R,5R)-2-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-5-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[(3R,5R)-2-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-5-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134937707 |
| Molecular Formula | C31H35N3O4Si |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 3-[(3R,5R)-2-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazolidin-5-yl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@H](n2c(=O)cc[nH]c2=O)ON1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35N3O4Si/c1-31(2,3)39(26-15-9-5-10-16-26,27-17-11-6-12-18-27)37-23-25-21-29(34-28(35)19-20-32-30(34)36)38-33(25)22-24-13-7-4-8-14-24/h4-20,25,29H,21-23H2,1-3H3,(H,32,36)/t25-,29-/m1/s1 |
| InChIKey | BDEPYJOBXXBDHF-VAVYLYDRSA-N |
| XLogP | 3.82 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|