C30H39NOSi — CID 68912098
(1-benzyl-4,4-dimethylpyrrolidin-3-yl)methoxy-tert-butyl-diphenylsilane (PubChem CID 68912098) has the molecular formula C30H39NOSi and a molecular weight of 457.73 g/mol. Its IUPAC name is (1-benzyl-4,4-dimethylpyrrolidin-3-yl)methoxy-tert-butyl-diphenylsilane.
| Compound Name | (1-benzyl-4,4-dimethylpyrrolidin-3-yl)methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 68912098 |
| Molecular Formula | C30H39NOSi |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (1-benzyl-4,4-dimethylpyrrolidin-3-yl)methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)CN(Cc2ccccc2)CC1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H39NOSi/c1-29(2,3)33(27-17-11-7-12-18-27,28-19-13-8-14-20-28)32-23-26-22-31(24-30(26,4)5)21-25-15-9-6-10-16-25/h6-20,26H,21-24H2,1-5H3 |
| InChIKey | BRKFPPQDOAIBQE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|