C23H27BrOSi — CID 140733360
[(1R,2R)-2-(2-bromoethynyl)-2-methylcyclopropyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 140733360) has the molecular formula C23H27BrOSi and a molecular weight of 427.46 g/mol. Its IUPAC name is [(1R,2R)-2-(2-bromoethynyl)-2-methylcyclopropyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,2R)-2-(2-bromoethynyl)-2-methylcyclopropyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 140733360 |
| Molecular Formula | C23H27BrOSi |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [(1R,2R)-2-(2-bromoethynyl)-2-methylcyclopropyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@]1(C)C#CBr)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27BrOSi/c1-22(2,3)26(20-11-7-5-8-12-20,21-13-9-6-10-14-21)25-18-19-17-23(19,4)15-16-24/h5-14,19H,17-18H2,1-4H3/t19-,23+/m0/s1 |
| InChIKey | BMZXIVXCGVTNCT-WMZHIEFXSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|