C28H31FO3Si — CID 142743872
[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropyl]methyl benzoate (PubChem CID 142743872) has the molecular formula C28H31FO3Si and a molecular weight of 462.64 g/mol. Its IUPAC name is [(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropyl]methyl benzoate.
| Compound Name | [(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropyl]methyl benzoate |
|---|---|
| PubChem CID | 142743872 |
| Molecular Formula | C28H31FO3Si |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-fluorocyclopropyl]methyl benzoate |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@]1(F)COC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31FO3Si/c1-27(2,3)33(24-15-9-5-10-16-24,25-17-11-6-12-18-25)32-20-23-19-28(23,29)21-31-26(30)22-13-7-4-8-14-22/h4-18,23H,19-21H2,1-3H3/t23-,28+/m1/s1 |
| InChIKey | LTYKIPPTSSQLBQ-LXFBAYGMSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|