C35H48N2O3Si — CID 170594522
tert-butyl N-[[1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-yl]methyl]-N-methylcarbamate (PubChem CID 170594522) has the molecular formula C35H48N2O3Si and a molecular weight of 572.87 g/mol. Its IUPAC name is tert-butyl N-[[1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170594522 |
| Molecular Formula | C35H48N2O3Si |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | tert-butyl N-[[1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN(CC1CCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H48N2O3Si/c1-34(2,3)40-33(38)36(7)26-29-23-24-30(37(29)25-28-17-11-8-12-18-28)27-39-41(35(4,5)6,31-19-13-9-14-20-31)32-21-15-10-16-22-32/h8-22,29-30H,23-27H2,1-7H3 |
| InChIKey | FKPBBBJFKULAPO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|