C21H26N2O2 — CID 90977597
(2S)-2,4-dibenzyl-5,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 90977597) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2S)-2,4-dibenzyl-5,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-2,4-dibenzyl-5,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 90977597 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2S)-2,4-dibenzyl-5,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)O)[C@@H](Cc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-21(2)16-23(20(24)25)19(13-17-9-5-3-6-10-17)15-22(21)14-18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | ZSXLCOWLISLMBZ-IBGZPJMESA-N |
| XLogP | 3.87 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |