C24H27N3O6S3 — CID 562883
1,3,5-tris[(2-methylphenyl)sulfonyl]-1,3,5-triazinane (PubChem CID 562883) has the molecular formula C24H27N3O6S3 and a molecular weight of 549.70 g/mol. Its IUPAC name is 1,3,5-tris[(2-methylphenyl)sulfonyl]-1,3,5-triazinane.
| Compound Name | 1,3,5-tris[(2-methylphenyl)sulfonyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 562883 |
| Molecular Formula | C24H27N3O6S3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 1,3,5-tris[(2-methylphenyl)sulfonyl]-1,3,5-triazinane |
| SMILES | Cc1ccccc1S(=O)(=O)N1CN(S(=O)(=O)c2ccccc2C)CN(S(=O)(=O)c2ccccc2C)C1 |
| InChI | InChI=1S/C24H27N3O6S3/c1-19-10-4-7-13-22(19)34(28,29)25-16-26(35(30,31)23-14-8-5-11-20(23)2)18-27(17-25)36(32,33)24-15-9-6-12-21(24)3/h4-15H,16-18H2,1-3H3 |
| InChIKey | UAYBLRWYOAUFDI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |