C12H11NO4S — CID 139892071
3-methylidene-1-(2-methylphenyl)sulfonylpyrrolidine-2,5-dione (PubChem CID 139892071) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-methylidene-1-(2-methylphenyl)sulfonylpyrrolidine-2,5-dione.
| Compound Name | 3-methylidene-1-(2-methylphenyl)sulfonylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139892071 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-methylidene-1-(2-methylphenyl)sulfonylpyrrolidine-2,5-dione |
| SMILES | C=C1CC(=O)N(S(=O)(=O)c2ccccc2C)C1=O |
| InChI | InChI=1S/C12H11NO4S/c1-8-5-3-4-6-10(8)18(16,17)13-11(14)7-9(2)12(13)15/h3-6H,2,7H2,1H3 |
| InChIKey | CFVRRIGBRCLSEZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|