C28H22N2O6S2 — CID 1381888
5,11-bis[(2-methylphenyl)sulfonyl]benzo[c][1,5]benzodiazocine-6,12-dione (PubChem CID 1381888) has the molecular formula C28H22N2O6S2 and a molecular weight of 546.63 g/mol. Its IUPAC name is 5,11-bis[(2-methylphenyl)sulfonyl]benzo[c][1,5]benzodiazocine-6,12-dione.
| Compound Name | 5,11-bis[(2-methylphenyl)sulfonyl]benzo[c][1,5]benzodiazocine-6,12-dione |
|---|---|
| PubChem CID | 1381888 |
| Molecular Formula | C28H22N2O6S2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 5,11-bis[(2-methylphenyl)sulfonyl]benzo[c][1,5]benzodiazocine-6,12-dione |
| SMILES | Cc1ccccc1S(=O)(=O)N1C(=O)c2ccccc2N(S(=O)(=O)c2ccccc2C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H22N2O6S2/c1-19-11-3-9-17-25(19)37(33,34)29-23-15-7-5-13-21(23)28(32)30(24-16-8-6-14-22(24)27(29)31)38(35,36)26-18-10-4-12-20(26)2/h3-18H,1-2H3 |
| InChIKey | JNOWYFZVJNYTLF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |